Products 89793-69-1
CAS 89793-69-1 is the registry number for 2,4-Dichloro-5-(2-chloroethyl)-6-methylpyrimidine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2,4-dichloro-5-(2-chloroethyl)-6-methylpyrimidine (CAS 89793-69-1) is a chemical compound with the molecular formula C7H7Cl3N2 and a molecular weight of 225.5 g/mol. IUPAC name: 2,4-dichloro-5-(2-chloroethyl)-6-methylpyrimidine. InChIKey: ZEDIRTAHPSPMSW-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl3N2 |
|---|---|
| Molecular weight | 225.5 g/mol |
| IUPAC name | 2,4-dichloro-5-(2-chloroethyl)-6-methylpyrimidine |
| InChIKey | ZEDIRTAHPSPMSW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=N1)Cl)Cl)CCCl |
Computed by PubChem (NCBI)