CAS 3797-81-7 appears in our catalog under these names: 2,6-Dichloro-benzamidine hydrochloride, 95%, 2,6-Dichlorobenzimidamide hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
2,6-dichlorobenzenecarboximidamide;hydrochloride (CAS 3797-81-7) is a chemical compound with the molecular formula C7H7Cl3N2 and a molecular weight of 225.5 g/mol. IUPAC name: 2,6-dichlorobenzenecarboximidamide;hydrochloride. InChIKey: XSQXZSIWHQCGMM-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl3N2 |
|---|---|
| Molecular weight | 225.5 g/mol |
| IUPAC name | 2,6-dichlorobenzenecarboximidamide;hydrochloride |
| InChIKey | XSQXZSIWHQCGMM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(=N)N)Cl.Cl |
Computed by PubChem (NCBI)