CAS 154505-50-7 appears in our catalog under these names: 2,4-Dichloro-benzamidine hydrochloride, 95%, 2,4-Dichlorobenzimidamide hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2,4-dichlorobenzenecarboximidamide;hydrochloride (CAS 154505-50-7) is a chemical compound with the molecular formula C7H7Cl3N2 and a molecular weight of 225.5 g/mol. IUPAC name: 2,4-dichlorobenzenecarboximidamide;hydrochloride. InChIKey: CIPUZYQYFMMYAF-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl3N2 |
|---|---|
| Molecular weight | 225.5 g/mol |
| IUPAC name | 2,4-dichlorobenzenecarboximidamide;hydrochloride |
| InChIKey | CIPUZYQYFMMYAF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(=N)N.Cl |
Computed by PubChem (NCBI)