CAS 1199-53-7 is the registry number for 4,5,6-Trichloro-2-isopropylpyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,5,6-trichloro-2-propan-2-ylpyrimidine (CAS 1199-53-7) is a chemical compound with the molecular formula C7H7Cl3N2 and a molecular weight of 225.5 g/mol. IUPAC name: 4,5,6-trichloro-2-propan-2-ylpyrimidine. InChIKey: ATGYGVVUZSGNKF-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl3N2 |
|---|---|
| Molecular weight | 225.5 g/mol |
| IUPAC name | 4,5,6-trichloro-2-propan-2-ylpyrimidine |
| InChIKey | ATGYGVVUZSGNKF-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC(=C(C(=N1)Cl)Cl)Cl |
Computed by PubChem (NCBI)