CAS 1172016-00-0 is the registry number for 2,5-Dichlorobenzimidamide hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,5-dichlorobenzenecarboximidamide;hydrochloride (CAS 1172016-00-0) is a chemical compound with the molecular formula C7H7Cl3N2 and a molecular weight of 225.5 g/mol. IUPAC name: 2,5-dichlorobenzenecarboximidamide;hydrochloride. InChIKey: KRTFKXTVRWBDCA-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl3N2 |
|---|---|
| Molecular weight | 225.5 g/mol |
| IUPAC name | 2,5-dichlorobenzenecarboximidamide;hydrochloride |
| InChIKey | KRTFKXTVRWBDCA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=N)N)Cl.Cl |
Computed by PubChem (NCBI)