CAS 898228-37-0 appears in our catalog under these names: Methyl 1-boc-3-methylazetidine-3-carboxylate, 95%, 1-tert-Butyl 3-methyl 3-methylazetidine-1,3-dicarboxylate, 97%, 1-tert-Butyl 3-methyl 3-methylazetidine-1,3-dicarboxylate, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 25g.
1-O-tert-butyl 3-O-methyl 3-methylazetidine-1,3-dicarboxylate (CAS 898228-37-0) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl 3-methylazetidine-1,3-dicarboxylate. InChIKey: PRWCITKRUVKOEQ-UHFFFAOYSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl 3-methylazetidine-1,3-dicarboxylate |
| InChIKey | PRWCITKRUVKOEQ-UHFFFAOYSA-N |
| SMILES | CC1(CN(C1)C(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)