Products 900783-19-9
CAS 900783-19-9 is the registry number for PDF-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(5-bromo-1H-indol-3-yl)-N-hydroxyacetamide (CAS 900783-19-9) is a chemical compound with the molecular formula C10H9BrN2O2 and a molecular weight of 269.09 g/mol. IUPAC name: 2-(5-bromo-1H-indol-3-yl)-N-hydroxyacetamide. InChIKey: ZDQORGWUODGWFT-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | 2-(5-bromo-1H-indol-3-yl)-N-hydroxyacetamide |
| InChIKey | ZDQORGWUODGWFT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=CN2)CC(=O)NO |
Computed by PubChem (NCBI)