CAS 90097-45-3 appears in our catalog under these names: 3-(Hydroxymethyl)-2(1H)-quinolinone, 3–(Hydroxymethyl)quinolin–2(1H)–one. Offered by: Biosynth, GLPBio. Available pack sizes: 5g, 0,5g, 250mg.
3-(hydroxymethyl)-1H-quinolin-2-one (CAS 90097-45-3) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 3-(hydroxymethyl)-1H-quinolin-2-one. InChIKey: VHJYMYGHHCHEDA-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 3-(hydroxymethyl)-1H-quinolin-2-one |
| InChIKey | VHJYMYGHHCHEDA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=O)N2)CO |
Computed by PubChem (NCBI)