Products 901124-75-2
CAS 901124-75-2 is the registry number for 8-Bromo-2-(chloromethyl)-6-methylimidazo[1,2-a]pyridine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-2-(chloromethyl)-6-methylimidazo[1,2-a]pyridine (CAS 901124-75-2) is a chemical compound with the molecular formula C9H8BrClN2 and a molecular weight of 259.53 g/mol. IUPAC name: 8-bromo-2-(chloromethyl)-6-methylimidazo[1,2-a]pyridine. InChIKey: KFBJSJRPHMGWNC-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClN2 |
|---|---|
| Molecular weight | 259.53 g/mol |
| IUPAC name | 8-bromo-2-(chloromethyl)-6-methylimidazo[1,2-a]pyridine |
| InChIKey | KFBJSJRPHMGWNC-UHFFFAOYSA-N |
| SMILES | CC1=CN2C=C(N=C2C(=C1)Br)CCl |
Computed by PubChem (NCBI)