CAS 2375920-20-8 is the registry number for 5-bromo-4-chloro-2,3-dimethyl-indazole, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
5-bromo-4-chloro-2,3-dimethylindazole (CAS 2375920-20-8) is a chemical compound with the molecular formula C9H8BrClN2 and a molecular weight of 259.53 g/mol. IUPAC name: 5-bromo-4-chloro-2,3-dimethylindazole. InChIKey: UOYRLEOTCRFKAM-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClN2 |
|---|---|
| Molecular weight | 259.53 g/mol |
| IUPAC name | 5-bromo-4-chloro-2,3-dimethylindazole |
| InChIKey | UOYRLEOTCRFKAM-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=NN1C)C=CC(=C2Cl)Br |
Computed by PubChem (NCBI)