CAS 2914920-46-8 appears in our catalog under these names: 5-Bromo-4-chloro-3-ethyl-1H-pyrrolo[2,3-b]pyridine, 98%, 5-Br-4-Cl-Pyrrolo-pyroxypyridine. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
5-bromo-4-chloro-3-ethyl-1H-pyrrolo[2,3-b]pyridine (CAS 2914920-46-8) is a chemical compound with the molecular formula C9H8BrClN2 and a molecular weight of 259.53 g/mol. IUPAC name: 5-bromo-4-chloro-3-ethyl-1H-pyrrolo[2,3-b]pyridine. InChIKey: HIMILBOOXZSIPP-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClN2 |
|---|---|
| Molecular weight | 259.53 g/mol |
| IUPAC name | 5-bromo-4-chloro-3-ethyl-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | HIMILBOOXZSIPP-UHFFFAOYSA-N |
| SMILES | CCC1=CNC2=NC=C(C(=C12)Cl)Br |
Computed by PubChem (NCBI)