CAS 297760-76-0 appears in our catalog under these names: 5-Bromo-quinolin-8-ylamine hydrochloride, 95%, 5-Bromoquinolin-8-amine hydrochloride, 98+%, 5-Bromoquinolin-8-amine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
5-bromoquinolin-8-amine;hydrochloride (CAS 297760-76-0) is a chemical compound with the molecular formula C9H8BrClN2 and a molecular weight of 259.53 g/mol. IUPAC name: 5-bromoquinolin-8-amine;hydrochloride. InChIKey: PXRMUKRCAFQNLK-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClN2 |
|---|---|
| Molecular weight | 259.53 g/mol |
| IUPAC name | 5-bromoquinolin-8-amine;hydrochloride |
| InChIKey | PXRMUKRCAFQNLK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)N)Br.Cl |
Computed by PubChem (NCBI)