CAS 2667056-05-3 is the registry number for 4-Bromo-6-chloro-1,5-dimethyl-1H-indazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-6-chloro-1,5-dimethylindazole (CAS 2667056-05-3) is a chemical compound with the molecular formula C9H8BrClN2 and a molecular weight of 259.53 g/mol. IUPAC name: 4-bromo-6-chloro-1,5-dimethylindazole. InChIKey: CPKHUOBTPFEHFQ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClN2 |
|---|---|
| Molecular weight | 259.53 g/mol |
| IUPAC name | 4-bromo-6-chloro-1,5-dimethylindazole |
| InChIKey | CPKHUOBTPFEHFQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C2C(=C1Br)C=NN2C)Cl |
Computed by PubChem (NCBI)