CAS 901599-43-7 appears in our catalog under these names: 5-HT3 antagonist 5/ 99.41% (existing batch purity), 5–HT3 antagonist 5, 5-HT3 antagonist 5, 99.75%, N-(4-Methoxyphenyl)quinoxaline-2-carboxamide, 98%, 98%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM/1mL.
N-(4-methoxyphenyl)quinoxaline-2-carboxamide (CAS 901599-43-7) is a chemical compound with the molecular formula C16H13N3O2 and a molecular weight of 279.29 g/mol. IUPAC name: N-(4-methoxyphenyl)quinoxaline-2-carboxamide. InChIKey: UUFCEPQEIQOEAL-UHFFFAOYSA-N.
| Molecular formula | C16H13N3O2 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | N-(4-methoxyphenyl)quinoxaline-2-carboxamide |
| InChIKey | UUFCEPQEIQOEAL-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NC(=O)C2=NC3=CC=CC=C3N=C2 |
Computed by PubChem (NCBI)