CAS 901926-72-5 appears in our catalog under these names: 3-(Pyridin-3-yl)-1,2-oxazole-5-carboxylic acid, 98%, 3-(Pyridin-3-yl)-1,2-oxazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-pyridin-3-yl-1,2-oxazole-5-carboxylic acid (CAS 901926-72-5) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 3-pyridin-3-yl-1,2-oxazole-5-carboxylic acid. InChIKey: CERJIBSFCWRHGZ-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 3-pyridin-3-yl-1,2-oxazole-5-carboxylic acid |
| InChIKey | CERJIBSFCWRHGZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NOC(=C2)C(=O)O |
Computed by PubChem (NCBI)