CAS 902456-05-7 is the registry number for 1-(2,3-Dichlorophenyl)piperazine 1-Oxide. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
1-(2,3-dichlorophenyl)-1-oxidopiperazin-1-ium (CAS 902456-05-7) is a chemical compound with the molecular formula C10H12Cl2N2O and a molecular weight of 247.12 g/mol. IUPAC name: 1-(2,3-dichlorophenyl)-1-oxidopiperazin-1-ium. InChIKey: SNXXLUFOGLVZGD-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2O |
|---|---|
| Molecular weight | 247.12 g/mol |
| IUPAC name | 1-(2,3-dichlorophenyl)-1-oxidopiperazin-1-ium |
| InChIKey | SNXXLUFOGLVZGD-UHFFFAOYSA-N |
| SMILES | C1C[N+](CCN1)(C2=C(C(=CC=C2)Cl)Cl)[O-] |
Computed by PubChem (NCBI)