CAS 902837-63-2 appears in our catalog under these names: 2-(4-Trifluoromethoxyphenyl)propionic acid, 95%, 2–(4–(trifluoromethoxy)phenyl)propanoic acid, 2-(4-(TRIFLUOROMETHOXY)PHENYL)PROPANOIC ACID, 95%, α-Methyl-4-(trifluoromethoxy)benzeneacetic acid. Offered by: Combi-blocks, GLPBio, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 10g, 50mg.
2-[4-(trifluoromethoxy)phenyl]propanoic acid (CAS 902837-63-2) is a chemical compound with the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. IUPAC name: 2-[4-(trifluoromethoxy)phenyl]propanoic acid. InChIKey: BEBMIASBVSVAQI-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O3 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | 2-[4-(trifluoromethoxy)phenyl]propanoic acid |
| InChIKey | BEBMIASBVSVAQI-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)OC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)