CAS 903555-97-5 appears in our catalog under these names: 1-Amino-2,3-dihydro-1H-indene-5-carbonitrile hydrochloride, 95%, 1-Amino-2,3-dihydro-1H-indene-5-carbonitrile hydrochloride, 1-Amino-2,3-dihydro-1H-indene-5-carbonitrile hydrochloride, 95%, 95%, 1-AMINO-2,3-DIHYDRO-1H-INDENE-5-CARBONITRILE HCL, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 50mg, 100mg, 250mg, 500mg, 1g.
1-amino-2,3-dihydro-1H-indene-5-carbonitrile;hydrochloride (CAS 903555-97-5) is a chemical compound with the molecular formula C10H11ClN2 and a molecular weight of 194.66 g/mol. IUPAC name: 1-amino-2,3-dihydro-1H-indene-5-carbonitrile;hydrochloride. InChIKey: UEHYVKYSUSWVFS-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2 |
|---|---|
| Molecular weight | 194.66 g/mol |
| IUPAC name | 1-amino-2,3-dihydro-1H-indene-5-carbonitrile;hydrochloride |
| InChIKey | UEHYVKYSUSWVFS-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1N)C=CC(=C2)C#N.Cl |
Computed by PubChem (NCBI)