CAS 903556-00-3 appears in our catalog under these names: (R)-1-Amino-2,3-dihydro-1H-indene-5-carbonitrile hydrochloride, 97%, (r)-1-Amino-2,3-dihydro-1h-indene-5-carbonitrile hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 5g, 0,05g, 0,025g, 0,1g, 0,25g.
(1R)-1-amino-2,3-dihydro-1H-indene-5-carbonitrile;hydrochloride (CAS 903556-00-3) is a chemical compound with the molecular formula C10H11ClN2 and a molecular weight of 194.66 g/mol. IUPAC name: (1R)-1-amino-2,3-dihydro-1H-indene-5-carbonitrile;hydrochloride. InChIKey: UEHYVKYSUSWVFS-HNCPQSOCSA-N.
| Molecular formula | C10H11ClN2 |
|---|---|
| Molecular weight | 194.66 g/mol |
| IUPAC name | (1R)-1-amino-2,3-dihydro-1H-indene-5-carbonitrile;hydrochloride |
| InChIKey | UEHYVKYSUSWVFS-HNCPQSOCSA-N |
| SMILES | C1CC2=C([C@@H]1N)C=CC(=C2)C#N.Cl |
Computed by PubChem (NCBI)