CAS 90361-55-0 is the registry number for 4-Methyl-2-phenyl-2-oxazoline-5-one, 97%. Offered by: AmBeed. Available pack sizes: 5g.
4-methyl-2-phenyl-4H-1,3-oxazol-5-one (CAS 90361-55-0) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 4-methyl-2-phenyl-4H-1,3-oxazol-5-one. InChIKey: HHPTWKXNGPGQJH-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 4-methyl-2-phenyl-4H-1,3-oxazol-5-one |
| InChIKey | HHPTWKXNGPGQJH-UHFFFAOYSA-N |
| SMILES | CC1C(=O)OC(=N1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)