CAS 904824-73-3 is the registry number for Diamino-L-Tyrosine. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-3-(3,5-diamino-4-hydroxyphenyl)propanoic acid (CAS 904824-73-3) is a chemical compound with the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. IUPAC name: (2S)-2-amino-3-(3,5-diamino-4-hydroxyphenyl)propanoic acid. InChIKey: VPNHZIPMNHLIRB-ZETCQYMHSA-N.
| Molecular formula | C9H13N3O3 |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | (2S)-2-amino-3-(3,5-diamino-4-hydroxyphenyl)propanoic acid |
| InChIKey | VPNHZIPMNHLIRB-ZETCQYMHSA-N |
| SMILES | C1=C(C=C(C(=C1N)O)N)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)