Products 90559-19-6
CAS 90559-19-6 appears in our catalog under these names: 1,2,3,4-Tetrahydroquinoxaline-2-carboxamide, 95%, 1,2,3,4-Tetrahydroquinoxaline-2-carboxamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1,2,3,4-tetrahydroquinoxaline-2-carboxamide (CAS 90559-19-6) is a chemical compound with the molecular formula C9H11N3O and a molecular weight of 177.20 g/mol. IUPAC name: 1,2,3,4-tetrahydroquinoxaline-2-carboxamide. InChIKey: XUUYVFJOLKENPD-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 1,2,3,4-tetrahydroquinoxaline-2-carboxamide |
| InChIKey | XUUYVFJOLKENPD-UHFFFAOYSA-N |
| SMILES | C1C(NC2=CC=CC=C2N1)C(=O)N |
Computed by PubChem (NCBI)