CAS 90562-30-4 appears in our catalog under these names: 2-(4-Chloro-phenyl)-cyclopropylamine hydrochloride, 97%, 2-(4-chlorophenyl)cyclopropan-1-amine (hydrochloride), 97%, 97%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 100mg.
2-(4-chlorophenyl)cyclopropan-1-amine;hydrochloride (CAS 90562-30-4) is a chemical compound with the molecular formula C9H11Cl2N and a molecular weight of 204.09 g/mol. IUPAC name: 2-(4-chlorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: PARPLJNCMHCNAA-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N |
|---|---|
| Molecular weight | 204.09 g/mol |
| IUPAC name | 2-(4-chlorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | PARPLJNCMHCNAA-UHFFFAOYSA-N |
| SMILES | C1C(C1N)C2=CC=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)