Products 90582-32-4
CAS 90582-32-4 is the registry number for 5-Oxobicyclo(2.2.1)heptane-2,3-dicarboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-oxobicyclo[2.2.1]heptane-2,3-dicarboxylic acid (CAS 90582-32-4) is a chemical compound with the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. IUPAC name: 5-oxobicyclo[2.2.1]heptane-2,3-dicarboxylic acid. InChIKey: WJAOMMCYWSWQJD-UHFFFAOYSA-N.
| Molecular formula | C9H10O5 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | 5-oxobicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
| InChIKey | WJAOMMCYWSWQJD-UHFFFAOYSA-N |
| SMILES | C1C2CC(=O)C1C(C2C(=O)O)C(=O)O |
Computed by PubChem (NCBI)