CAS 90717-07-0 appears in our catalog under these names: 7-Chloroquinoline-3,8-dicarboxylic acid, 97%, Quinmerac metabolite BH 518-2, Quinmerac metabolite BH 518-2 100 µg/mL in Acetone, Quinmerac-3,8-dicarboxylic Acid (>90%), 7-Chloroquinoline-3,8-dicarboxylic acid. Offered by: AmBeed, Dr. Ehrenstorfer, TRC, Biosynth, HPC Standards. Available pack sizes: 1g, 10mg, 1ml, 25mg, 50mg, 5mg, 1x10mg, 1x1ml.
7-chloroquinoline-3,8-dicarboxylic acid (CAS 90717-07-0) is a chemical compound with the molecular formula C11H6ClNO4 and a molecular weight of 251.62 g/mol. IUPAC name: 7-chloroquinoline-3,8-dicarboxylic acid. InChIKey: ZYIDIAPHYHJMCU-UHFFFAOYSA-N.
| Molecular formula | C11H6ClNO4 |
|---|---|
| Molecular weight | 251.62 g/mol |
| IUPAC name | 7-chloroquinoline-3,8-dicarboxylic acid |
| InChIKey | ZYIDIAPHYHJMCU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=NC=C(C=C21)C(=O)O)C(=O)O)Cl |
Computed by PubChem (NCBI)