CAS 90767-01-4 appears in our catalog under these names: 4–Bromo–2–nitronaphthalen–1–amine, 4-Bromo-2-nitronaphthalen-1-amine 95%, 4-Bromo-2-nitronaphthalen-1-amine, 95%, 4-Bromo-2-nitronaphthalen-1-amine, 95%, 95%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 250mg, 2.5g, 10g, 100mg.
4-bromo-2-nitronaphthalen-1-amine (CAS 90767-01-4) is a chemical compound with the molecular formula C10H7BrN2O2 and a molecular weight of 267.08 g/mol. IUPAC name: 4-bromo-2-nitronaphthalen-1-amine. InChIKey: HDIRDIWTOYQFJI-UHFFFAOYSA-N.
| Molecular formula | C10H7BrN2O2 |
|---|---|
| Molecular weight | 267.08 g/mol |
| IUPAC name | 4-bromo-2-nitronaphthalen-1-amine |
| InChIKey | HDIRDIWTOYQFJI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=C2N)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)