Products 90772-28-4
CAS 90772-28-4 appears in our catalog under these names: 1-(4-Bromophenyl)dihydropyrimidine-2,4(1H,3H)-dione, 97%, 97%, 1-(4-Bromophenyl)dihydropyrimidine-2,4(1H,3H)-dione, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg, 10g.
1-(4-bromophenyl)-1,3-diazinane-2,4-dione (CAS 90772-28-4) is a chemical compound with the molecular formula C10H9BrN2O2 and a molecular weight of 269.09 g/mol. IUPAC name: 1-(4-bromophenyl)-1,3-diazinane-2,4-dione. InChIKey: QBQRRWPLTOBGST-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | 1-(4-bromophenyl)-1,3-diazinane-2,4-dione |
| InChIKey | QBQRRWPLTOBGST-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)