Products 908334-18-9
CAS 908334-18-9 appears in our catalog under these names: 3-(3-Piperidinyl)benzoic acid, 95%, 3-(Piperidin-3-yl)benzoic acid hydrochloride, 95%, 3-(piperidin-3-yl)benzoic acid hydrochloride, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 500mg, 5g, 10g.
3-piperidin-3-ylbenzoic acid (CAS 908334-18-9) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: 3-piperidin-3-ylbenzoic acid. InChIKey: QXTVCJWHSMRFIX-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | 3-piperidin-3-ylbenzoic acid |
| InChIKey | QXTVCJWHSMRFIX-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)