Products 90841-46-6
CAS 90841-46-6 appears in our catalog under these names: Methyl 4–Bromo–2，6–Dimethylbenzoate, Methyl 4-bromo-2,6-diMethylbenzoate, Methyl 4-bromo-2,6-dimethylbenzoate 95%, Benzoic acid, 4-bromo-2,6-dimethyl-, methyl ester, 95%, 95%, Methyl 4-bromo-2,6-dimethylbenzoate, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 2,5g, 250mg, 10g, 100g.
Methyl 4-bromo-2,6-dimethylbenzoate (CAS 90841-46-6) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: methyl 4-bromo-2,6-dimethylbenzoate. InChIKey: HBAMBTOWPNCADR-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | methyl 4-bromo-2,6-dimethylbenzoate |
| InChIKey | HBAMBTOWPNCADR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)OC)C)Br |
Computed by PubChem (NCBI)