CAS 908803-38-3 is the registry number for PARP1-IN-30. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-chloro-5,8-dihydroxy-3-thiomorpholin-4-ylnaphthalene-1,4-dione (CAS 908803-38-3) is a chemical compound with the molecular formula C14H12ClNO4S and a molecular weight of 325.8 g/mol. IUPAC name: 2-chloro-5,8-dihydroxy-3-thiomorpholin-4-ylnaphthalene-1,4-dione. InChIKey: MXUQEKATIIOLDW-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO4S |
|---|---|
| Molecular weight | 325.8 g/mol |
| IUPAC name | 2-chloro-5,8-dihydroxy-3-thiomorpholin-4-ylnaphthalene-1,4-dione |
| InChIKey | MXUQEKATIIOLDW-UHFFFAOYSA-N |
| SMILES | C1CSCCN1C2=C(C(=O)C3=C(C=CC(=C3C2=O)O)O)Cl |
Computed by PubChem (NCBI)