Products 909091-78-7

CAS 909091-78-7 is the registry number for 2,4-Dihydrochromeno[4,3-c]pyrazole-3-carboxylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

2,4-dihydrochromeno[4,3-c]pyrazole-3-carboxylic acid (CAS 909091-78-7) is a chemical compound with the molecular formula C11H8N2O3 and a molecular weight of 216.19 g/mol. IUPAC name: 2,4-dihydrochromeno[4,3-c]pyrazole-3-carboxylic acid. InChIKey: LCCZBCRICIYZCV-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8N2O3
Molecular weight216.19 g/mol
IUPAC name2,4-dihydrochromeno[4,3-c]pyrazole-3-carboxylic acid
InChIKeyLCCZBCRICIYZCV-UHFFFAOYSA-N
SMILESC1C2=C(NN=C2C3=CC=CC=C3O1)C(=O)O

Computed by PubChem (NCBI)