CAS 909091-78-7 is the registry number for 2,4-Dihydrochromeno[4,3-c]pyrazole-3-carboxylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 1g, 5g.
2,4-dihydrochromeno[4,3-c]pyrazole-3-carboxylic acid (CAS 909091-78-7) is a chemical compound with the molecular formula C11H8N2O3 and a molecular weight of 216.19 g/mol. IUPAC name: 2,4-dihydrochromeno[4,3-c]pyrazole-3-carboxylic acid. InChIKey: LCCZBCRICIYZCV-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O3 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | 2,4-dihydrochromeno[4,3-c]pyrazole-3-carboxylic acid |
| InChIKey | LCCZBCRICIYZCV-UHFFFAOYSA-N |
| SMILES | C1C2=C(NN=C2C3=CC=CC=C3O1)C(=O)O |
Computed by PubChem (NCBI)