CAS 249292-44-2 appears in our catalog under these names: 4-(6-Oxo-1,6-dihydropyridazin-3-yl)benzoic acid, 95%, 4–(6–oxo–1,6–dihydropyridazin–3–yl)benzoic acid, -4(6-oxo-1,6-dihydropyridazin-3-yl)benzoic acid, 4-(6-OXO-1,6-DIHYDROPYRIDAZIN-3-YL)BENZOIC ACID, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 100mg, 50mg, 0,5g.
4-(6-oxo-1H-pyridazin-3-yl)benzoic acid (CAS 249292-44-2) is a chemical compound with the molecular formula C11H8N2O3 and a molecular weight of 216.19 g/mol. IUPAC name: 4-(6-oxo-1H-pyridazin-3-yl)benzoic acid. InChIKey: VOCMUCJYMGABRT-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O3 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | 4-(6-oxo-1H-pyridazin-3-yl)benzoic acid |
| InChIKey | VOCMUCJYMGABRT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNC(=O)C=C2)C(=O)O |
Computed by PubChem (NCBI)