CAS 4783-89-5 appears in our catalog under these names: 4-(3-Nitrophenoxy)pyridine, 95%, 4–(3–nitro–phenoxy)–pyridine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 250mg, 1g.
4-(3-nitrophenoxy)pyridine (CAS 4783-89-5) is a chemical compound with the molecular formula C11H8N2O3 and a molecular weight of 216.19 g/mol. IUPAC name: 4-(3-nitrophenoxy)pyridine. InChIKey: LATNLEGVUWFTII-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O3 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | 4-(3-nitrophenoxy)pyridine |
| InChIKey | LATNLEGVUWFTII-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=CC=NC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)