CAS 412339-01-6 appears in our catalog under these names: 6-Oxo-1-phenyl-1,6-dihydropyridazine-3-carboxylic acid, 95%, 6-Oxo-1-phenyl-1,6-dihydropyridazine-3-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 0,5g, 2g.
6-oxo-1-phenylpyridazine-3-carboxylic acid (CAS 412339-01-6) is a chemical compound with the molecular formula C11H8N2O3 and a molecular weight of 216.19 g/mol. IUPAC name: 6-oxo-1-phenylpyridazine-3-carboxylic acid. InChIKey: AAVYIKIZGPTVFN-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O3 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | 6-oxo-1-phenylpyridazine-3-carboxylic acid |
| InChIKey | AAVYIKIZGPTVFN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C=CC(=N2)C(=O)O |
Computed by PubChem (NCBI)