CAS 909190-70-1 appears in our catalog under these names: 1–(3–Bromo–4–(bromomethyl)phenyl)ethan–1–one, 1-(3-Bromo-4-(bromomethyl)phenyl)ethan-1-one, 95%, 1-(3-broMo-4-(broMoMethyl)phenyl)ethanone, 95%, 95%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg.
1-[3-bromo-4-(bromomethyl)phenyl]ethanone (CAS 909190-70-1) is a chemical compound with the molecular formula C9H8Br2O and a molecular weight of 291.97 g/mol. IUPAC name: 1-[3-bromo-4-(bromomethyl)phenyl]ethanone. InChIKey: YCYQORKDKUHNBO-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2O |
|---|---|
| Molecular weight | 291.97 g/mol |
| IUPAC name | 1-[3-bromo-4-(bromomethyl)phenyl]ethanone |
| InChIKey | YCYQORKDKUHNBO-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)CBr)Br |
Computed by PubChem (NCBI)