Products 909344-67-8
CAS 909344-67-8 is the registry number for 4-(((4,4-dimethyl-2,6-dioxo-3,5-dioxanylidene)methyl)amino)benzamide. Offered by: Biosynth. Available pack sizes: 250mg.
4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzamide (CAS 909344-67-8) is a chemical compound with the molecular formula C14H14N2O5 and a molecular weight of 290.27 g/mol. IUPAC name: 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzamide. InChIKey: GJBYPCPNZVIJLT-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O5 |
|---|---|
| Molecular weight | 290.27 g/mol |
| IUPAC name | 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzamide |
| InChIKey | GJBYPCPNZVIJLT-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(=CNC2=CC=C(C=C2)C(=O)N)C(=O)O1)C |
Computed by PubChem (NCBI)