CAS 909702-86-9 appears in our catalog under these names: N-cyclopropyl 2,3-dimethylbenzylamine hydrochloride, 95%, N-(2,3-Dimethylbenzyl)cyclopropanamine hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
N-[(2,3-dimethylphenyl)methyl]cyclopropanamine;hydrochloride (CAS 909702-86-9) is a chemical compound with the molecular formula C12H18ClN and a molecular weight of 211.73 g/mol. IUPAC name: N-[(2,3-dimethylphenyl)methyl]cyclopropanamine;hydrochloride. InChIKey: WLLZUEMEHNSROV-UHFFFAOYSA-N.
| Molecular formula | C12H18ClN |
|---|---|
| Molecular weight | 211.73 g/mol |
| IUPAC name | N-[(2,3-dimethylphenyl)methyl]cyclopropanamine;hydrochloride |
| InChIKey | WLLZUEMEHNSROV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)CNC2CC2)C.Cl |
Computed by PubChem (NCBI)