Products 90985-57-2
CAS 90985-57-2 appears in our catalog under these names: 1-Desmethylobtusin, 1,2,8-Trihydroxy-6,7-dimethoxy-3-methyl-9,10-anthracenedione, ≥98%. Offered by: MedChemExpress, Chemat. Available pack sizes: Get quote, 5mg, 10mg, 20mg, 50mg, 100mg.
1,2,8-trihydroxy-6,7-dimethoxy-3-methylanthracene-9,10-dione (CAS 90985-57-2) is a chemical compound with the molecular formula C17H14O7 and a molecular weight of 330.29 g/mol. IUPAC name: 1,2,8-trihydroxy-6,7-dimethoxy-3-methylanthracene-9,10-dione. InChIKey: DQLZLEGJAFDFLO-UHFFFAOYSA-N.
| Molecular formula | C17H14O7 |
|---|---|
| Molecular weight | 330.29 g/mol |
| IUPAC name | 1,2,8-trihydroxy-6,7-dimethoxy-3-methylanthracene-9,10-dione |
| InChIKey | DQLZLEGJAFDFLO-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1O)O)C(=O)C3=C(C(=C(C=C3C2=O)OC)OC)O |
Computed by PubChem (NCBI)