Products 91076-99-2
CAS 91076-99-2 is the registry number for 3-Amino-5-(4-nitrophenyl)thiophene-2-carboxylic acid methyl ester, 95+%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g.
Methyl 3-amino-5-(4-nitrophenyl)thiophene-2-carboxylate (CAS 91076-99-2) is a chemical compound with the molecular formula C12H10N2O4S and a molecular weight of 278.29 g/mol. IUPAC name: methyl 3-amino-5-(4-nitrophenyl)thiophene-2-carboxylate. InChIKey: NVUFFVPGEHZJFW-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O4S |
|---|---|
| Molecular weight | 278.29 g/mol |
| IUPAC name | methyl 3-amino-5-(4-nitrophenyl)thiophene-2-carboxylate |
| InChIKey | NVUFFVPGEHZJFW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(S1)C2=CC=C(C=C2)[N+](=O)[O-])N |
Computed by PubChem (NCBI)