Products 911446-37-2

CAS 911446-37-2 is the registry number for 2-(Diethylamino)-3-phenylpropanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-(diethylamino)-3-phenylpropanoic acid (CAS 911446-37-2) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 221.29 g/mol. IUPAC name: 2-(diethylamino)-3-phenylpropanoic acid. InChIKey: OIJSDANCPHWBIZ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H19NO2
Molecular weight221.29 g/mol
IUPAC name2-(diethylamino)-3-phenylpropanoic acid
InChIKeyOIJSDANCPHWBIZ-UHFFFAOYSA-N
SMILESCCN(CC)C(CC1=CC=CC=C1)C(=O)O

Computed by PubChem (NCBI)