CAS 911804-98-3 is the registry number for 2-Butoxy-3-nitrotoluene, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-butoxy-1-methyl-3-nitrobenzene (CAS 911804-98-3) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: 2-butoxy-1-methyl-3-nitrobenzene. InChIKey: ZLHFRHIXCITJOW-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | 2-butoxy-1-methyl-3-nitrobenzene |
| InChIKey | ZLHFRHIXCITJOW-UHFFFAOYSA-N |
| SMILES | CCCCOC1=C(C=CC=C1[N+](=O)[O-])C |
Computed by PubChem (NCBI)