Products 91182-00-2
CAS 91182-00-2 appears in our catalog under these names: 4-Ethylamino-3-nitro-benzoic acid ethyl ester, 98%, Ethyl 4-(ethylamino)-3-nitrobenzoate, 98%, 4-Ethylamino-3-nitro-benzoic acid ethyl ester. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 2,5g.
Ethyl 4-(ethylamino)-3-nitrobenzoate (CAS 91182-00-2) is a chemical compound with the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. IUPAC name: ethyl 4-(ethylamino)-3-nitrobenzoate. InChIKey: IMXVAPWRGKQKOG-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O4 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | ethyl 4-(ethylamino)-3-nitrobenzoate |
| InChIKey | IMXVAPWRGKQKOG-UHFFFAOYSA-N |
| SMILES | CCNC1=C(C=C(C=C1)C(=O)OCC)[N+](=O)[O-] |
Computed by PubChem (NCBI)