CAS 912444-87-2 appears in our catalog under these names: 1-tert-Butyl 4-ethyl 5-hydroxyazepane-1,4-dicarboxylate, 98%, 1-tert-Butyl 4-ethyl 5-hydroxyazepane-1,4-dicarboxylate, 95%, 95%, 1-tert-Butyl 4-ethyl 5-hydroxyazepane-1,4-dicarboxylate, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
1-O-tert-butyl 4-O-ethyl 5-hydroxyazepane-1,4-dicarboxylate (CAS 912444-87-2) is a chemical compound with the molecular formula C14H25NO5 and a molecular weight of 287.35 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl 5-hydroxyazepane-1,4-dicarboxylate. InChIKey: AYRXKSVYGUPMAE-UHFFFAOYSA-N.
| Molecular formula | C14H25NO5 |
|---|---|
| Molecular weight | 287.35 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-ethyl 5-hydroxyazepane-1,4-dicarboxylate |
| InChIKey | AYRXKSVYGUPMAE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCN(CCC1O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)