Products 912641-18-0
CAS 912641-18-0 is the registry number for (1R,5S)-(-)-3-(4-Chlorophenyl)-8-azabicyclo[3.2.1]oct-2-ene, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(1R,5S)-3-(4-chlorophenyl)-8-azabicyclo[3.2.1]oct-2-ene (CAS 912641-18-0) is a chemical compound with the molecular formula C13H14ClN and a molecular weight of 219.71 g/mol. IUPAC name: (1R,5S)-3-(4-chlorophenyl)-8-azabicyclo[3.2.1]oct-2-ene. InChIKey: QBSBBGLHCMPGNO-OLZOCXBDSA-N.
| Molecular formula | C13H14ClN |
|---|---|
| Molecular weight | 219.71 g/mol |
| IUPAC name | (1R,5S)-3-(4-chlorophenyl)-8-azabicyclo[3.2.1]oct-2-ene |
| InChIKey | QBSBBGLHCMPGNO-OLZOCXBDSA-N |
| SMILES | C1C[C@@H]2C=C(C[C@H]1N2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)