Products 91348-83-3
CAS 91348-83-3 is the registry number for 6-Chloro-1,2,3,4-tetrahydronaphthalene-1-carbonitrile, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
6-chloro-1,2,3,4-tetrahydronaphthalene-1-carbonitrile (CAS 91348-83-3) is a chemical compound with the molecular formula C11H10ClN and a molecular weight of 191.65 g/mol. IUPAC name: 6-chloro-1,2,3,4-tetrahydronaphthalene-1-carbonitrile. InChIKey: BPGQPGCTLDOBME-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | 6-chloro-1,2,3,4-tetrahydronaphthalene-1-carbonitrile |
| InChIKey | BPGQPGCTLDOBME-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C=C(C=C2)Cl)C#N |
Computed by PubChem (NCBI)