CAS 3913-17-5 appears in our catalog under these names: 2-Chloro-4,8-dimethylquinoline, 98%, 2–Chloro–4,8–dimethylquinoline, 2-Chloro-4,8-dimethylquinoline, 98%, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg, 25g.
2-chloro-4,8-dimethylquinoline (CAS 3913-17-5) is a chemical compound with the molecular formula C11H10ClN and a molecular weight of 191.65 g/mol. IUPAC name: 2-chloro-4,8-dimethylquinoline. InChIKey: UAKXMKQZURGJKF-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | 2-chloro-4,8-dimethylquinoline |
| InChIKey | UAKXMKQZURGJKF-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=CC(=N2)Cl)C |
Computed by PubChem (NCBI)