CAS 139719-23-6 is the registry number for 2-Chloro-6,8-dimethylquinoline, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.
2-chloro-6,8-dimethylquinoline (CAS 139719-23-6) is a chemical compound with the molecular formula C11H10ClN and a molecular weight of 191.65 g/mol. IUPAC name: 2-chloro-6,8-dimethylquinoline. InChIKey: RTTGIGZPZSOSRA-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | 2-chloro-6,8-dimethylquinoline |
| InChIKey | RTTGIGZPZSOSRA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C=CC(=N2)Cl)C |
Computed by PubChem (NCBI)