CAS 914348-35-9 appears in our catalog under these names: 2,3–Difluoro–6–nitrotoluene, 2,3-Difluoro-6-nitrotoluene 95%, 2,3-Difluoro-6-nitrotoluene, 95%, 95%, 2,3-Difluoro-6-nitrotoluene, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 100g, 100mg, 50g.
1,2-difluoro-3-methyl-4-nitrobenzene (CAS 914348-35-9) is a chemical compound with the molecular formula C7H5F2NO2 and a molecular weight of 173.12 g/mol. IUPAC name: 1,2-difluoro-3-methyl-4-nitrobenzene. InChIKey: ODMLBEQUDLHJMW-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO2 |
|---|---|
| Molecular weight | 173.12 g/mol |
| IUPAC name | 1,2-difluoro-3-methyl-4-nitrobenzene |
| InChIKey | ODMLBEQUDLHJMW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)