CAS 91437-09-1 is the registry number for 2–DIFLUOROMETHYL–BENZOXAZOLE. Offered by: GLPBio. Available pack sizes: 1g.
2-(difluoromethyl)-1,3-benzoxazole (CAS 91437-09-1) is a chemical compound with the molecular formula C8H5F2NO and a molecular weight of 169.13 g/mol. IUPAC name: 2-(difluoromethyl)-1,3-benzoxazole. InChIKey: UDIPXWGWAFYJOU-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO |
|---|---|
| Molecular weight | 169.13 g/mol |
| IUPAC name | 2-(difluoromethyl)-1,3-benzoxazole |
| InChIKey | UDIPXWGWAFYJOU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)C(F)F |
Computed by PubChem (NCBI)