Products 914636-33-2
CAS 914636-33-2 is the registry number for N-(2-Amino-1,2-dinitrilovinyl)(propylamino)formamide. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 2000mg, 5000mg.
1-[(Z)-2-amino-1,2-dicyanoethenyl]-3-propylurea (CAS 914636-33-2) is a chemical compound with the molecular formula C8H11N5O and a molecular weight of 193.21 g/mol. IUPAC name: 1-[(Z)-2-amino-1,2-dicyanoethenyl]-3-propylurea. InChIKey: QOTYZXMDLZOQKZ-SREVYHEPSA-N.
| Molecular formula | C8H11N5O |
|---|---|
| Molecular weight | 193.21 g/mol |
| IUPAC name | 1-[(Z)-2-amino-1,2-dicyanoethenyl]-3-propylurea |
| InChIKey | QOTYZXMDLZOQKZ-SREVYHEPSA-N |
| SMILES | CCCNC(=O)N/C(=C(/C#N)\N)/C#N |
Computed by PubChem (NCBI)